Exams & Certification

The most effective antacid in the Antacids as Buffers simulationMultiple ChoiceA acted to suppress the cells that produce acid, rather than buffering the acid in the stomach.B did not buffer the added acid.C was phenol redD was able to receive the most acid before the pH dropped significantlyE received the least amount of acid before […]

Net exports is a negative number when:a. a nation’s imports of goods and services are greater than its exports.b. a nation’s imports of goods and services fall.c. a nation’s imports of goods and services rise.d. a nation’s exports of goods and services are greater than its imports. The correct answer and explanation is : The

What is the mass in grams of one formula unit of Na2SO3 The correct answer and explanation is : To calculate the mass in grams of one formula unit of sodium sulfite (Na₂SO₃), we need to determine the molar mass of the compound and then use Avogadro’s number to find the mass of a single

A sample of sodium sulfite (Na2SO3) has a mass of 2.25 g.a. How many Na+ ions are present?b. How many SO3²? ions are present?c. What is the mass in grams of one formula unit of Na2SO3? The correct answer and explanation is : Let’s solve each part of the question step by step. Given: Step

A sample of sodium sulfite (Na2SO3) has a mass of 2.25 g The correct answer and explanation is : To solve the problem where you are given a sample of sodium sulfite (Na₂SO₃) with a mass of 2.25 g, we need to determine the number of moles of sodium sulfite in the sample. This requires

If Actual (real) GDP is greater (more than) than potential GDP. then economy will experience a (an)a. Equilibriumb. Inflationary Gapc. Recessionary Gap.d. Depression The correct answer and explanation is : The correct answer is b. Inflationary Gap. Explanation: An Inflationary Gap occurs when the Actual GDP (the total value of goods and services produced in

According to Durkheim, which of the following is NOT a social fact? A A religious beliefB A religious belief, law, and custom are all social factsC A customD A law The correct answer and explanation is : The correct answer is B: A religious belief, law, and custom are all social facts. Explanation: Émile Durkheim,

New concepts are best learned if they are connected to: personal and cultural experiences.current events.a child-centered curriculum.a teacher-directed curriculum. The correct answer and explanation is : The correct answer is personal and cultural experiences. Explanation: When new concepts are connected to personal and cultural experiences, they become more meaningful and relevant to the learner. This

In ‘What is Racial Domination’, Desmond and Emirbayer outline five fallacies about racism. Which fallacy about racism claims that U.S. ?history is inconsequential? a. legalistic fallacy b. fixed fallacy c. tokenistic fallacy d, ahistorical fallacy The correct answer and explanation is : The correct answer is d. ahistorical fallacy. The ahistorical fallacy is one of

Determine what ions are present in the following compounds. Cr2O3PbCl4Na3PO4Al(ClO4)3SrSO4 The correct answer and explanation is : Let’s determine the ions present in the compounds: Explanation: The ions in each compound arise from the different oxidation states of the metals and non-metals involved, based on their positions in the periodic table. Metals such as sodium