Exams & Certification

Convert the following condensed structures into Bond-line structures: a) CH3CONHCH2OCH3 b) O(CH2)3CHCH3 c) CH3CHCHN(CH3)CH2CH3 d) (CH3)3CCH2CH2COOCH2CH3 e) CH3CH2CCCH2CO(CH2)2N(CH3)21. Convert the following condensed structures into Bond-line structures: a) CH3CONHCH2OCH3 b) O(CH2)3CHCH3 c) CH3CHCHN(CH3)CH2CH3 d) (CH3)3CCH2CH2COOCH2CH3 e) CH3CH2CCCH2CO(CH2)2N(CH3)2 f) CH3CH2C(CH3)CHCH(CH2)4 g) (CH3)2CCHCH2OCH(CH3)CH2CN h) CH3CH2CHClCHBrCH2CONHCH(CH3)2 i) (CH3)2CHCCCH2OCH(CH2Br)CH2CH3 j) CH3NHCHCCH3CHClCON(C2H5)2 The Correct Answer and Explanation is : To convert […]

Select all correct answers. An oxygen atom has 8 protons and 8 neutrons. This means that A. the atomic number of oxygen is 8 B. oxygen has 8 electrons C. the atomic mass of oxygen is 16 D. oxygen has 16 electrons E. the atomic number of oxygen is 16 F. the atomic mass of

Consider an atom of oxygen in which the nucleus contains 8 protons and 8 neutrons. If it is doubly ionized, what is the charge of the oxygen ion and how many electrons remain in the ion? A) Charge = +2; number of remaining electrons = 8. B) Charge = -2; number of remaining electrons =

How would a manager use systematic thinking and intuitive thinking in problem solving? The Correct Answer and Explanation is : A manager blends systematic thinking and intuitive thinking to effectively solve problems by leveraging the strengths of both approaches. In problem solving, effective managers often blend systematic thinking with intuitive thinking to achieve robust solutions.

What would happen if there were no Schwann cells? A) Muscles would not be able to contract and the body would be paralyzed. B) An increase in cerebrospinal fluid (CSF) within the spinal cord and brain would result in death. C) Bacteria and viruses would accumulate in the brain and would slowly cause neural destruction.

Weighted-average method, equivalent units. Consider the following data for the Assembly Division of Fenton Watches, Inc.: The Assembly Division uses the weighted-average method of process costing. The Correct Answer and Explanation is : To calculate the equivalent units using the weighted-average method for the Assembly Division of Fenton Watches, Inc., we follow these steps: 1.

Which of the following sely defines renal cortest statements accuratelyA) The most superficial region of the kidney, consisting mainly of blood vessels dut serve the nephronsB) The kidney’s innermost region, which serves as a basin for collecting unne C) Muscular hollow organ that contracts via peristalsis to propel urine from the renal pelvis to the

What are the reactions (with phases) and their balanced equation for a.)AgNO3+Na2SO4? b.)Pb(NO3)2+Na2SO4? c.) CaCl2+Na2SO4? The Correct Answer and Explanation is : Here are the balanced chemical equations with phases for the given reactions: (a) Silver Nitrate and Sodium Sulfate Reaction:[2AgNO_3 (aq) + Na_2SO_4 (aq) \rightarrow Ag_2SO_4 (s) + 2NaNO_3 (aq)]Explanation:When silver nitrate ((AgNO_3)) reacts

The enthalpy of fusion of anthracene is 28.8 kJ mol-1 and its melting point is 217°C. Calculate its ideal solubility in benzene at 25°C? (Mass of anthracene is 178.23 g/mol) The Correct Answer and Explanation is : Explanation: The ideal solubility of a solid in a liquid can be estimated using the van’t Hoff equation:

A bouquet of flowers costs $17.95. If a customer has a coupon that allows him to save $3.75 on the price of the flowers, how much will he pay for the flowers? Of the 600 people at a music festival, 420 had attended the previous year. How many people out of 100 had attended the